Hello,' I have seen from this link https://cran.r-project.org/web/packages/rcdk/vignettes/using-rcdk.html that there is a way to draw chemical structures using R via rcdk package. I tried to draw a simple structure but I got an error. What is it missing? What is the correct syntax? Thanks
``` library(rcdk) smile <- 'c1ccccc1CC(=O)C(N)CC1CCCCOC1' mol <- parse.smiles(smile)[[1]] view.molecule.2d(mol) > Error in view.molecule.2d(mol) : java.lang.NoSuchMethodError: <init> ``` ______________________________________________ R-help@r-project.org mailing list -- To UNSUBSCRIBE and more, see https://stat.ethz.ch/mailman/listinfo/r-help PLEASE do read the posting guide http://www.R-project.org/posting-guide.html and provide commented, minimal, self-contained, reproducible code.
